View source for Decene

{{short description|Organic compound (C10H20)}}
{{Distinguish|Decane|Decyne}}
{{Chembox
| Watchedfields = changed
| verifiedrevid = 443563584
| Name = Decene
| ImageFile1 = 1-decene.svg
| ImageFile2 = Dec-1-ene.svg
| PIN = Dec-1-ene
| OtherNames = Alpha Olefin C10; Decylene; α-Decene; 1-decene
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12809
| InChI = 1/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3
| InChIKey = AFFLGGQVNFXPEV-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H20/c1-3-5-7-9-10-8-6-4-2/h3H,1,4-10H2,2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AFFLGGQVNFXPEV-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 872-05-9 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7O4U4C718P
| PubChem = 13381
| EINECS = 212-819-2
| RTECS = HE2071401
| UNNumber = 3295, 1993
| ChEBI = 87315
| ChEMBL = 3187990
| SMILES = CCCCCCCCC=C
}}
|Section2={{Chembox Properties
| C=10 | H=20
| Density = 0.74 g/cm<sup>3</sup><ref name=GESTIS>{{GESTIS|ZVG=493774}}</ref>
| MeltingPtC = -66.3
| MeltingPt_ref = <ref name=GESTIS/>
| BoilingPtC = 172
| BoilingPt_ref = <ref name=GESTIS/>
  }}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS02}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|226|304|410}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|273|280|301+310|303+361+353|331|370+378|391|403+235|405|501}}
}}
|Section8={{Chembox Related
| OtherFunction_label = [[Alkene]]s
| OtherFunction = [[Octene]]<br />[[Nonene]]<br />[[Undecene]]<br />[[Dodecene]]
| OtherCompounds = [[Decane]]<br />[[Decanol]]
  }}
}}

'''Decene''' {{IPAc-en|d|ɛ|k|iː|n}} is an [[organic compound]] with the [[chemical formula]] {{chem2|C10H20}}. Decene contains a [[Catenation|chain]] of ten [[carbon]] atoms with one [[double bond]], making it an [[alkene]]. There are many [[isomer]]s of decene depending on the position and geometry of the double bond.  Dec-1-ene is the only isomer of industrial importance. As an [[alpha olefin]], it is used as a [[comonomer]] in [[copolymers]] and is an intermediate in the production of [[epoxide]]s, [[amine]]s, [[oxo alcohol]]s, synthetic lubricants, synthetic [[fatty acid]]s and alkylated [[aromatic]]s.<ref>http://www.ineosoligomers.com/media/files/lao/LAO%20C10%20Data%20Sheet.pdf 1-Decene (Alpha Olefin C10)], ineosoligomers.com</ref>

The industrial processes used in the production of dec-1-ene are [[oligomerization]] of [[ethylene]] by the [[Ziegler process]] or by the [[Fluid catalytic cracking|cracking]] of petrochemical waxes.<ref>[http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf Alfa Olefins] {{Webarchive|url=https://web.archive.org/web/20170517120901/http://www.inchem.org/documents/sids/sids/AOalfaolefins.pdf |date=2017-05-17 }}, SIDS Initial Assessment Report</ref>

In [[ethenolysis]], '''methyl oleate''', the ''methyl ester'' of [[oleic acid]], converts to [[1-decene]] and methyl 9-[[Decenoic acid|decenoate]]:<ref>{{ cite journal | last = Marinescu | first = Smaranda C. | last2 = Schrock | first2 = Richard R. | last3 = Müller | first3 = Peter | last4 = Hoveyda | first4 = Amir H. | title = Ethenolysis Reactions Catalyzed by Imido Alkylidene Monoaryloxide Monopyrrolide (MAP) Complexes of Molybdenum | journal = J. Am. Chem. Soc. | year = 2009 | volume = 131 | issue = 31 | pages = 10840–10841 | doi = 10.1021/ja904786y | pmid=19618951}}</ref>
::<math chem>\overset{\text{methyl oleate}}{\ce{CH3(CH2)7CH=CH(CH2)7CO2Me}} + {\color{red}\ce{CH2=CH2}} \longrightarrow \overset{\text{1-decene}}{\ce{CH3(CH2)7CH=}{\color{red}\ce{CH2}}} + \overset{\text{9-decenoate}}{\ce{MeO2C(CH2)7CH=}{\color{red}\ce{CH2}}}</math>

Dec-1-ene has been isolated from the leaves and [[rhizome]] of the plant ''[[Farfugium japonicum]]'' and has been detected as the initial product in the microbial degradation of ''n''-[[decane]].

==References==
{{reflist}}

==External links==
* {{Nist|id=C872059}}

{{Alkenes}}

{{Hydrides by group}}

[[Category:Alkenes]]